C28H34N10O5 — CID 87701257
N-[5-[(3-amino-1-cyano-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[bis(oxiran-2-ylmethyl)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 87701257) has the molecular formula C28H34N10O5 and a molecular weight of 590.65 g/mol. Its IUPAC name is N-[5-[(3-amino-1-cyano-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[bis(oxiran-2-ylmethyl)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[5-[(3-amino-1-cyano-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[bis(oxiran-2-ylmethyl)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 87701257 |
| Molecular Formula | C28H34N10O5 |
| Molecular Weight | 590.65 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | N-[5-[(3-amino-1-cyano-3-iminopropyl)carbamoyl]-1-methylpyrrol-3-yl]-4-[[4-[bis(oxiran-2-ylmethyl)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)CC(C#N)NC(=O)c1cc(NC(=O)c2cc(NC(=O)c3cc(N(CC4CO4)CC4CO4)cn3C)cn2C)cn1C |
| InChI | InChI=1S/C28H34N10O5/c1-35-9-17(4-22(35)26(39)32-16(8-29)6-25(30)31)33-27(40)23-5-18(10-36(23)2)34-28(41)24-7-19(11-37(24)3)38(12-20-14-42-20)13-21-15-43-21/h4-5,7,9-11,16,20-21H,6,12-15H2,1-3H3,(H3,30,31)(H,32,39)(H,33,40)(H,34,41) |
| InChIKey | UZSZERGQAMQHDM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 204.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|