C20H30N10O2 — CID 59891583
N-(4-amino-4-methyliminobutyl)-4-[[4-[(1,3-diamino-3-iminopropylidene)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide (PubChem CID 59891583) has the molecular formula C20H30N10O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is N-(4-amino-4-methyliminobutyl)-4-[[4-[(1,3-diamino-3-iminopropylidene)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(4-amino-4-methyliminobutyl)-4-[[4-[(1,3-diamino-3-iminopropylidene)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 59891583 |
| Molecular Formula | C20H30N10O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | N-(4-amino-4-methyliminobutyl)-4-[[4-[(1,3-diamino-3-iminopropylidene)amino]-1-methylpyrrole-2-carbonyl]amino]-1-methylpyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)C/C(N)=N/c1cc(C(=O)Nc2cc(C(=O)NCCC/C(N)=N/C)n(C)c2)n(C)c1 |
| InChI | InChI=1S/C20H30N10O2/c1-25-17(23)5-4-6-26-19(31)14-8-13(11-29(14)2)28-20(32)15-7-12(10-30(15)3)27-18(24)9-16(21)22/h7-8,10-11H,4-6,9H2,1-3H3,(H3,21,22)(H2,23,25)(H2,24,27)(H,26,31)(H,28,32) |
| InChIKey | CXNQIPWRMCIEPF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 194.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|