C21H32GeN10O2 — CID 59953891
CID 59953891 (PubChem CID 59953891) has the molecular formula C21H32GeN10O2 and a molecular weight of 529.17 g/mol.
| Compound Name | CID 59953891 |
|---|---|
| PubChem CID | 59953891 |
| Molecular Formula | C21H32GeN10O2 |
| Molecular Weight | 529.17 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | — |
| SMILES | [H]/N=C(N)/C(N)=N/c1cc(C(=O)Nc2cc(C(=O)NCCC/C(N)=N/CC[Ge]C)n(C)c2)n(C)c1 |
| InChI | InChI=1S/C21H32GeN10O2/c1-22-6-8-27-17(23)5-4-7-28-20(33)15-10-14(12-31(15)2)30-21(34)16-9-13(11-32(16)3)29-19(26)18(24)25/h9-12H,4-8H2,1-3H3,(H2,23,27)(H3,24,25)(H2,26,29)(H,28,33)(H,30,34) |
| InChIKey | PRZAFKBNAKYSPE-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 194.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|