C29H39ClN4O5 — CID 87704721
(2R)-N-(3-aminopropyl)-2-[[1-(4,4-dimethyl-2,3-dioxohexanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide;hydrochloride (PubChem CID 87704721) has the molecular formula C29H39ClN4O5 and a molecular weight of 559.11 g/mol. Its IUPAC name is (2R)-N-(3-aminopropyl)-2-[[1-(4,4-dimethyl-2,3-dioxohexanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide;hydrochloride.
| Compound Name | (2R)-N-(3-aminopropyl)-2-[[1-(4,4-dimethyl-2,3-dioxohexanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 87704721 |
| Molecular Formula | C29H39ClN4O5 |
| Molecular Weight | 559.11 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | (2R)-N-(3-aminopropyl)-2-[[1-(4,4-dimethyl-2,3-dioxohexanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide;hydrochloride |
| SMILES | CCC(C)(C)C(=O)C(=O)C(=O)N1CCCC1N(C=O)[C@H](Cc1ccc2ccccc2c1)C(=O)NCCCN.Cl |
| InChI | InChI=1S/C29H38N4O5.ClH/c1-4-29(2,3)26(36)25(35)28(38)32-16-7-11-24(32)33(19-34)23(27(37)31-15-8-14-30)18-20-12-13-21-9-5-6-10-22(21)17-20;/h5-6,9-10,12-13,17,19,23-24H,4,7-8,11,14-16,18,30H2,1-3H3,(H,31,37);1H/t23-,24?;/m1./s1 |
| InChIKey | YGHJJPUQALPSOM-MTJIYFAESA-N |
| XLogP | 2.62 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|