C34H44N4O3 — CID 87919977
(2R)-N-[3-(benzylamino)propyl]-2-[[1-(2-ethylbutanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide (PubChem CID 87919977) has the molecular formula C34H44N4O3 and a molecular weight of 556.75 g/mol. Its IUPAC name is (2R)-N-[3-(benzylamino)propyl]-2-[[1-(2-ethylbutanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide.
| Compound Name | (2R)-N-[3-(benzylamino)propyl]-2-[[1-(2-ethylbutanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 87919977 |
| Molecular Formula | C34H44N4O3 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | (2R)-N-[3-(benzylamino)propyl]-2-[[1-(2-ethylbutanoyl)pyrrolidin-2-yl]-formylamino]-3-naphthalen-2-ylpropanamide |
| SMILES | CCC(CC)C(=O)N1CCCC1N(C=O)[C@H](Cc1ccc2ccccc2c1)C(=O)NCCCNCc1ccccc1 |
| InChI | InChI=1S/C34H44N4O3/c1-3-28(4-2)34(41)37-21-10-16-32(37)38(25-39)31(23-27-17-18-29-14-8-9-15-30(29)22-27)33(40)36-20-11-19-35-24-26-12-6-5-7-13-26/h5-9,12-15,17-18,22,25,28,31-32,35H,3-4,10-11,16,19-21,23-24H2,1-2H3,(H,36,40)/t31-,32?/m1/s1 |
| InChIKey | VOFOWLJBIVEDGX-XGDNGBMYSA-N |
| XLogP | 4.89 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|