About 5-ethylundecan-6-yloxy hydrogen carbonate
5-ethylundecan-6-yloxy hydrogen carbonate (PubChem CID 87718198) has the molecular formula C14H28O4
and a molecular weight of 260.37 g/mol. Its IUPAC name is 5-ethylundecan-6-yloxy hydrogen carbonate.
Molecular Properties
| Compound Name | 5-ethylundecan-6-yloxy hydrogen carbonate |
| PubChem CID | 87718198 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 5-ethylundecan-6-yloxy hydrogen carbonate |
| SMILES | CCCCCC(OOC(=O)O)C(CC)CCCC |
| InChI | InChI=1S/C14H28O4/c1-4-7-9-11-13(17-18-14(15)16)12(6-3)10-8-5-2/h12-13H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | QHKIMKVEJDFVMK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-ethylundecan-6-yloxy hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylundecan-6-yloxy hydrogen carbonate?
The IUPAC name of 5-ethylundecan-6-yloxy hydrogen carbonate (CID 87718198) is 5-ethylundecan-6-yloxy hydrogen carbonate.
What is the SMILES notation for 5-ethylundecan-6-yloxy hydrogen carbonate?
The canonical SMILES for 5-ethylundecan-6-yloxy hydrogen carbonate is CCCCCC(OOC(=O)O)C(CC)CCCC.
What is the InChIKey of 5-ethylundecan-6-yloxy hydrogen carbonate?
The InChIKey is QHKIMKVEJDFVMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O4/c1-4-7-9-11-13(17-18-14(15)16)12(6-3)10-8-5-2/h12-13H,4-11H2,1-3H3,(H,15,16).
What are the key properties of 5-ethylundecan-6-yloxy hydrogen carbonate?
5-ethylundecan-6-yloxy hydrogen carbonate has a molecular weight of 260.37 g/mol, XLogP of 4.78, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylundecan-6-yloxy hydrogen carbonate is sourced from PubChem (CID 87718198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).