About 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel
6-ethyldecan-5-yloxy(oxo)phosphanium;nickel (PubChem CID 160585258) has the molecular formula C12H26NiO2P+
and a molecular weight of 292.00 g/mol. Its IUPAC name is 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel.
Molecular Properties
| Compound Name | 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel |
| PubChem CID | 160585258 |
| Molecular Formula | C12H26NiO2P+ |
| Molecular Weight | 292.00 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel |
| SMILES | CCCCC(CC)C(CCCC)O[PH+]=O.[Ni] |
| InChI | InChI=1S/C12H26O2P.Ni/c1-4-7-9-11(6-3)12(14-15-13)10-8-5-2;/h11-12,15H,4-10H2,1-3H3;/q+1; |
| InChIKey | KVXDHEZNFBNHFX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.00 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel?
The IUPAC name of 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel (CID 160585258) is 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel.
What is the SMILES notation for 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel?
The canonical SMILES for 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel is CCCCC(CC)C(CCCC)O[PH+]=O.[Ni].
What is the InChIKey of 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel?
The InChIKey is KVXDHEZNFBNHFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2P.Ni/c1-4-7-9-11(6-3)12(14-15-13)10-8-5-2;/h11-12,15H,4-10H2,1-3H3;/q+1;.
What are the key properties of 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel?
6-ethyldecan-5-yloxy(oxo)phosphanium;nickel has a molecular weight of 292.00 g/mol, XLogP of 4.71, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyldecan-5-yloxy(oxo)phosphanium;nickel is sourced from PubChem (CID 160585258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).