About 6-ethyldecan-5-yloxy hydrogen carbonate
6-ethyldecan-5-yloxy hydrogen carbonate (PubChem CID 87793236) has the molecular formula C13H26O4
and a molecular weight of 246.35 g/mol. Its IUPAC name is 6-ethyldecan-5-yloxy hydrogen carbonate.
Molecular Properties
| Compound Name | 6-ethyldecan-5-yloxy hydrogen carbonate |
| PubChem CID | 87793236 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 6-ethyldecan-5-yloxy hydrogen carbonate |
| SMILES | CCCCC(CC)C(CCCC)OOC(=O)O |
| InChI | InChI=1S/C13H26O4/c1-4-7-9-11(6-3)12(10-8-5-2)16-17-13(14)15/h11-12H,4-10H2,1-3H3,(H,14,15) |
| InChIKey | OORSIWGLELGDRQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyldecan-5-yloxy hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyldecan-5-yloxy hydrogen carbonate?
The IUPAC name of 6-ethyldecan-5-yloxy hydrogen carbonate (CID 87793236) is 6-ethyldecan-5-yloxy hydrogen carbonate.
What is the SMILES notation for 6-ethyldecan-5-yloxy hydrogen carbonate?
The canonical SMILES for 6-ethyldecan-5-yloxy hydrogen carbonate is CCCCC(CC)C(CCCC)OOC(=O)O.
What is the InChIKey of 6-ethyldecan-5-yloxy hydrogen carbonate?
The InChIKey is OORSIWGLELGDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O4/c1-4-7-9-11(6-3)12(10-8-5-2)16-17-13(14)15/h11-12H,4-10H2,1-3H3,(H,14,15).
What are the key properties of 6-ethyldecan-5-yloxy hydrogen carbonate?
6-ethyldecan-5-yloxy hydrogen carbonate has a molecular weight of 246.35 g/mol, XLogP of 4.39, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyldecan-5-yloxy hydrogen carbonate is sourced from PubChem (CID 87793236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).