C4H5F3N2O3S — CID 87721714
1H-pyrazole;trifluoromethanesulfonic acid (PubChem CID 87721714) has the molecular formula C4H5F3N2O3S and a molecular weight of 218.16 g/mol. Its IUPAC name is 1H-pyrazole;trifluoromethanesulfonic acid.
| Compound Name | 1H-pyrazole;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 87721714 |
| Molecular Formula | C4H5F3N2O3S |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | 1H-pyrazole;trifluoromethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)F.c1cn[nH]c1 |
| InChI | InChI=1S/C3H4N2.CHF3O3S/c1-2-4-5-3-1;2-1(3,4)8(5,6)7/h1-3H,(H,4,5);(H,5,6,7) |
| InChIKey | BBSSGZGMTOVGJT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|