C24H28N4OS2 — CID 87723502
1-[5-[2-(carbamothioylamino)-4-methylphenoxy]pentyl]-3-naphthalen-1-ylthiourea (PubChem CID 87723502) has the molecular formula C24H28N4OS2 and a molecular weight of 452.65 g/mol. Its IUPAC name is 1-[5-[2-(carbamothioylamino)-4-methylphenoxy]pentyl]-3-naphthalen-1-ylthiourea.
| Compound Name | 1-[5-[2-(carbamothioylamino)-4-methylphenoxy]pentyl]-3-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 87723502 |
| Molecular Formula | C24H28N4OS2 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1-[5-[2-(carbamothioylamino)-4-methylphenoxy]pentyl]-3-naphthalen-1-ylthiourea |
| SMILES | Cc1ccc(OCCCCCNC(=S)Nc2cccc3ccccc23)c(NC(N)=S)c1 |
| InChI | InChI=1S/C24H28N4OS2/c1-17-12-13-22(21(16-17)27-23(25)30)29-15-6-2-5-14-26-24(31)28-20-11-7-9-18-8-3-4-10-19(18)20/h3-4,7-13,16H,2,5-6,14-15H2,1H3,(H3,25,27,30)(H2,26,28,31) |
| InChIKey | IQIBDHSYZHFJLJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|