C29H32N4O4S2 — CID 90834146
1-[2-[8-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea (PubChem CID 90834146) has the molecular formula C29H32N4O4S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 1-[2-[8-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea.
| Compound Name | 1-[2-[8-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea |
|---|---|
| PubChem CID | 90834146 |
| Molecular Formula | C29H32N4O4S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 1-[2-[8-[(2-methoxydibenzofuran-3-yl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea |
| SMILES | COc1cc2c(cc1NC(=S)NCCCCCCCCOc1ccccc1NC(=O)N=S)oc1ccccc12 |
| InChI | InChI=1S/C29H32N4O4S2/c1-35-27-18-21-20-12-6-8-14-24(20)37-26(21)19-23(27)32-29(38)30-16-10-4-2-3-5-11-17-36-25-15-9-7-13-22(25)31-28(34)33-39/h6-9,12-15,18-19H,2-5,10-11,16-17H2,1H3,(H,31,34)(H2,30,32,38) |
| InChIKey | GMDYIHODNCZGCP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|