C25H30N6O2S2 — CID 91238551
1-[2-[8-[(4-pyrazol-1-ylphenyl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea (PubChem CID 91238551) has the molecular formula C25H30N6O2S2 and a molecular weight of 510.69 g/mol. Its IUPAC name is 1-[2-[8-[(4-pyrazol-1-ylphenyl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea.
| Compound Name | 1-[2-[8-[(4-pyrazol-1-ylphenyl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea |
|---|---|
| PubChem CID | 91238551 |
| Molecular Formula | C25H30N6O2S2 |
| Molecular Weight | 510.69 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 1-[2-[8-[(4-pyrazol-1-ylphenyl)carbamothioylamino]octoxy]phenyl]-3-sulfanylideneurea |
| SMILES | O=C(N=S)Nc1ccccc1OCCCCCCCCNC(=S)Nc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C25H30N6O2S2/c32-24(30-35)29-22-10-5-6-11-23(22)33-19-8-4-2-1-3-7-16-26-25(34)28-20-12-14-21(15-13-20)31-18-9-17-27-31/h5-6,9-15,17-18H,1-4,7-8,16,19H2,(H,29,32)(H2,26,28,34) |
| InChIKey | NHHBNVRGPLFTBR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 92.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|