C19H21BrN4O2S2 — CID 91033906
1-[2-[5-[(4-bromophenyl)carbamothioylamino]pentoxy]phenyl]-3-sulfanylideneurea (PubChem CID 91033906) has the molecular formula C19H21BrN4O2S2 and a molecular weight of 481.44 g/mol. Its IUPAC name is 1-[2-[5-[(4-bromophenyl)carbamothioylamino]pentoxy]phenyl]-3-sulfanylideneurea.
| Compound Name | 1-[2-[5-[(4-bromophenyl)carbamothioylamino]pentoxy]phenyl]-3-sulfanylideneurea |
|---|---|
| PubChem CID | 91033906 |
| Molecular Formula | C19H21BrN4O2S2 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 1-[2-[5-[(4-bromophenyl)carbamothioylamino]pentoxy]phenyl]-3-sulfanylideneurea |
| SMILES | O=C(N=S)Nc1ccccc1OCCCCCNC(=S)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrN4O2S2/c20-14-8-10-15(11-9-14)22-19(27)21-12-4-1-5-13-26-17-7-3-2-6-16(17)23-18(25)24-28/h2-3,6-11H,1,4-5,12-13H2,(H,23,25)(H2,21,22,27) |
| InChIKey | GPQLUQSFQKXKDU-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|