C29H32N4O2S2 — CID 90767074
1-[2-[8-(9H-fluoren-2-ylcarbamothioylamino)octoxy]phenyl]-3-sulfanylideneurea (PubChem CID 90767074) has the molecular formula C29H32N4O2S2 and a molecular weight of 532.74 g/mol. Its IUPAC name is 1-[2-[8-(9H-fluoren-2-ylcarbamothioylamino)octoxy]phenyl]-3-sulfanylideneurea.
| Compound Name | 1-[2-[8-(9H-fluoren-2-ylcarbamothioylamino)octoxy]phenyl]-3-sulfanylideneurea |
|---|---|
| PubChem CID | 90767074 |
| Molecular Formula | C29H32N4O2S2 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 1-[2-[8-(9H-fluoren-2-ylcarbamothioylamino)octoxy]phenyl]-3-sulfanylideneurea |
| SMILES | O=C(N=S)Nc1ccccc1OCCCCCCCCNC(=S)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C29H32N4O2S2/c34-28(33-37)32-26-13-7-8-14-27(26)35-18-10-4-2-1-3-9-17-30-29(36)31-23-15-16-25-22(20-23)19-21-11-5-6-12-24(21)25/h5-8,11-16,20H,1-4,9-10,17-19H2,(H,32,34)(H2,30,31,36) |
| InChIKey | YXZPJTQVWVRTQZ-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|