C19H35NO6P+ — CID 87724338
butyl 2-methylprop-2-enoate;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium (PubChem CID 87724338) has the molecular formula C19H35NO6P+ and a molecular weight of 404.46 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium.
| Compound Name | butyl 2-methylprop-2-enoate;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 87724338 |
| Molecular Formula | C19H35NO6P+ |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | butyl 2-methylprop-2-enoate;[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium |
| SMILES | C=C(C)C(=O)OCCCC.C=C(C)C(=O)OCCP(O)C(=O)C[N+](C)(C)C |
| InChI | InChI=1S/C11H21NO4P.C8H14O2/c1-9(2)11(14)16-6-7-17(15)10(13)8-12(3,4)5;1-4-5-6-10-8(9)7(2)3/h15H,1,6-8H2,2-5H3;2,4-6H2,1,3H3/q+1; |
| InChIKey | KGWGBZFNIYJLKD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|