C15H26NO6P — CID 87864558
[2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium;2-methylprop-2-enoate (PubChem CID 87864558) has the molecular formula C15H26NO6P and a molecular weight of 347.35 g/mol. Its IUPAC name is [2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium;2-methylprop-2-enoate.
| Compound Name | [2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium;2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87864558 |
| Molecular Formula | C15H26NO6P |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [2-[hydroxy-[2-(2-methylprop-2-enoyloxy)ethyl]phosphanyl]-2-oxoethyl]-trimethylazanium;2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCP(O)C(=O)C[N+](C)(C)C.C=C(C)C(=O)[O-] |
| InChI | InChI=1S/C11H21NO4P.C4H6O2/c1-9(2)11(14)16-6-7-17(15)10(13)8-12(3,4)5;1-3(2)4(5)6/h15H,1,6-8H2,2-5H3;1H2,2H3,(H,5,6)/q+1;/p-1 |
| InChIKey | KLPDYDPVFXCYQG-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|