C17H26N2O3 — CID 87727301
(2S)-2-(3,4-dimethoxyphenyl)-2-(3-propan-2-ylpiperazin-1-yl)acetaldehyde (PubChem CID 87727301) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethoxyphenyl)-2-(3-propan-2-ylpiperazin-1-yl)acetaldehyde.
| Compound Name | (2S)-2-(3,4-dimethoxyphenyl)-2-(3-propan-2-ylpiperazin-1-yl)acetaldehyde |
|---|---|
| PubChem CID | 87727301 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (2S)-2-(3,4-dimethoxyphenyl)-2-(3-propan-2-ylpiperazin-1-yl)acetaldehyde |
| SMILES | COc1ccc([C@@H](C=O)N2CCNC(C(C)C)C2)cc1OC |
| InChI | InChI=1S/C17H26N2O3/c1-12(2)14-10-19(8-7-18-14)15(11-20)13-5-6-16(21-3)17(9-13)22-4/h5-6,9,11-12,14-15,18H,7-8,10H2,1-4H3/t14?,15-/m1/s1 |
| InChIKey | LXVKDJOXBNXDLA-YSSOQSIOSA-N |
| XLogP | 1.87 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|