C34H54CaO8S2 — CID 87740923
calcium bis(1-(3,5-ditert-butyl-4-hydroxyphenyl)propane-2-sulfonic acid) (PubChem CID 87740923) has the molecular formula C34H54CaO8S2 and a molecular weight of 695.01 g/mol. Its IUPAC name is calcium bis(1-(3,5-ditert-butyl-4-hydroxyphenyl)propane-2-sulfonic acid).
| Compound Name | calcium bis(1-(3,5-ditert-butyl-4-hydroxyphenyl)propane-2-sulfonic acid) |
|---|---|
| PubChem CID | 87740923 |
| Molecular Formula | C34H54CaO8S2 |
| Molecular Weight | 695.01 g/mol |
| Exact Mass | 694.29 |
| IUPAC Name | calcium bis(1-(3,5-ditert-butyl-4-hydroxyphenyl)propane-2-sulfonic acid) |
| SMILES | C[C-](Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)S(=O)(=O)O.C[C-](Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)S(=O)(=O)O.[Ca+2] |
| InChI | InChI=1S/2C17H27O4S.Ca/c2*1-11(22(19,20)21)8-12-9-13(16(2,3)4)15(18)14(10-12)17(5,6)7;/h2*9-10,18H,8H2,1-7H3,(H,19,20,21);/q2*-1;+2 |
| InChIKey | ZWYWZSKIOLXAGC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.01 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|