C34H54O8P2 — CID 122446939
2,6-ditert-butyl-4-[[7-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,7-dioxo-1,3,6,8,2λ5,7λ5-tetraoxadiphosphecan-2-yl]methyl]phenol (PubChem CID 122446939) has the molecular formula C34H54O8P2 and a molecular weight of 652.75 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[[7-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,7-dioxo-1,3,6,8,2λ5,7λ5-tetraoxadiphosphecan-2-yl]methyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[[7-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,7-dioxo-1,3,6,8,2λ5,7λ5-tetraoxadiphosphecan-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 122446939 |
| Molecular Formula | C34H54O8P2 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.33 |
| IUPAC Name | 2,6-ditert-butyl-4-[[7-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]-2,7-dioxo-1,3,6,8,2λ5,7λ5-tetraoxadiphosphecan-2-yl]methyl]phenol |
| SMILES | CC(C)(C)c1cc(CP2(=O)OCCOP(=O)(Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)OCCO2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C34H54O8P2/c1-31(2,3)25-17-23(18-26(29(25)35)32(4,5)6)21-43(37)39-13-15-41-44(38,42-16-14-40-43)22-24-19-27(33(7,8)9)30(36)28(20-24)34(10,11)12/h17-20,35-36H,13-16,21-22H2,1-12H3 |
| InChIKey | XKPNXNIHAAVUNE-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|