About 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel
2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel (PubChem CID 87741873) has the molecular formula C11H8N2NiO4
and a molecular weight of 290.89 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel |
| PubChem CID | 87741873 |
| Molecular Formula | C11H8N2NiO4 |
| Molecular Weight | 290.89 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel |
| SMILES | O=C(O)c1ccccc1C(=O)Oc1ncc[nH]1.[Ni] |
| InChI | InChI=1S/C11H8N2O4.Ni/c14-9(15)7-3-1-2-4-8(7)10(16)17-11-12-5-6-13-11;/h1-6H,(H,12,13)(H,14,15); |
| InChIKey | FIUVJJQXOZHSFZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.89 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel?
The IUPAC name of 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel (CID 87741873) is 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel.
What is the SMILES notation for 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel?
The canonical SMILES for 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel is O=C(O)c1ccccc1C(=O)Oc1ncc[nH]1.[Ni].
What is the InChIKey of 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel?
The InChIKey is FIUVJJQXOZHSFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O4.Ni/c14-9(15)7-3-1-2-4-8(7)10(16)17-11-12-5-6-13-11;/h1-6H,(H,12,13)(H,14,15);.
What are the key properties of 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel?
2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel has a molecular weight of 290.89 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yloxycarbonyl)benzoic acid;nickel is sourced from PubChem (CID 87741873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).