C22H30N2O4 — CID 70432647
2-[2-(1H-imidazol-2-yl)undecoxycarbonyl]benzoic acid (PubChem CID 70432647) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-2-yl)undecoxycarbonyl]benzoic acid.
| Compound Name | 2-[2-(1H-imidazol-2-yl)undecoxycarbonyl]benzoic acid |
|---|---|
| PubChem CID | 70432647 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | 2-[2-(1H-imidazol-2-yl)undecoxycarbonyl]benzoic acid |
| SMILES | CCCCCCCCCC(COC(=O)c1ccccc1C(=O)O)c1ncc[nH]1 |
| InChI | InChI=1S/C22H30N2O4/c1-2-3-4-5-6-7-8-11-17(20-23-14-15-24-20)16-28-22(27)19-13-10-9-12-18(19)21(25)26/h9-10,12-15,17H,2-8,11,16H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | PBRCFLZHLASZBM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|