About 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate
1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate (PubChem CID 87744186) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate.
Molecular Properties
| Compound Name | 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate |
| PubChem CID | 87744186 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate |
| SMILES | C=CNC(=O)CCC(=O)OC(=C)N |
| InChI | InChI=1S/C8H12N2O3/c1-3-10-7(11)4-5-8(12)13-6(2)9/h3H,1-2,4-5,9H2,(H,10,11) |
| InChIKey | UNHWQZLLRZTWLS-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate?
The IUPAC name of 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate (CID 87744186) is 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate.
What is the SMILES notation for 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate?
The canonical SMILES for 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate is C=CNC(=O)CCC(=O)OC(=C)N.
What is the InChIKey of 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate?
The InChIKey is UNHWQZLLRZTWLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3/c1-3-10-7(11)4-5-8(12)13-6(2)9/h3H,1-2,4-5,9H2,(H,10,11).
What are the key properties of 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate?
1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate has a molecular weight of 184.19 g/mol, XLogP of -0.00, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethenyl 4-(ethenylamino)-4-oxobutanoate is sourced from PubChem (CID 87744186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).