C21H22N2O6S — CID 87745429
methyl 5-[ethyl-[3-methyl-4-(1,3-oxazol-4-yl)phenoxy]sulfamoyl]-2-methylbenzoate (PubChem CID 87745429) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is methyl 5-[ethyl-[3-methyl-4-(1,3-oxazol-4-yl)phenoxy]sulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[ethyl-[3-methyl-4-(1,3-oxazol-4-yl)phenoxy]sulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 87745429 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | methyl 5-[ethyl-[3-methyl-4-(1,3-oxazol-4-yl)phenoxy]sulfamoyl]-2-methylbenzoate |
| SMILES | CCN(Oc1ccc(-c2cocn2)c(C)c1)S(=O)(=O)c1ccc(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C21H22N2O6S/c1-5-23(29-16-7-9-18(15(3)10-16)20-12-28-13-22-20)30(25,26)17-8-6-14(2)19(11-17)21(24)27-4/h6-13H,5H2,1-4H3 |
| InChIKey | JJEQBOQLEVHZPO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|