C24H28N2O5S2 — CID 87747264
methyl 5-[[4-(2-tert-butyl-1,3-thiazol-4-yl)phenoxy]-ethylsulfamoyl]-2-methylbenzoate (PubChem CID 87747264) has the molecular formula C24H28N2O5S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is methyl 5-[[4-(2-tert-butyl-1,3-thiazol-4-yl)phenoxy]-ethylsulfamoyl]-2-methylbenzoate.
| Compound Name | methyl 5-[[4-(2-tert-butyl-1,3-thiazol-4-yl)phenoxy]-ethylsulfamoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 87747264 |
| Molecular Formula | C24H28N2O5S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | methyl 5-[[4-(2-tert-butyl-1,3-thiazol-4-yl)phenoxy]-ethylsulfamoyl]-2-methylbenzoate |
| SMILES | CCN(Oc1ccc(-c2csc(C(C)(C)C)n2)cc1)S(=O)(=O)c1ccc(C)c(C(=O)OC)c1 |
| InChI | InChI=1S/C24H28N2O5S2/c1-7-26(33(28,29)19-13-8-16(2)20(14-19)22(27)30-6)31-18-11-9-17(10-12-18)21-15-32-23(25-21)24(3,4)5/h8-15H,7H2,1-6H3 |
| InChIKey | ILAOREWOBNMTKU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|