C10H8N2O5 — CID 87747113
(3S)-3-(2-nitroanilino)oxolane-2,5-dione (PubChem CID 87747113) has the molecular formula C10H8N2O5 and a molecular weight of 236.18 g/mol. Its IUPAC name is (3S)-3-(2-nitroanilino)oxolane-2,5-dione.
| Compound Name | (3S)-3-(2-nitroanilino)oxolane-2,5-dione |
|---|---|
| PubChem CID | 87747113 |
| Molecular Formula | C10H8N2O5 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (3S)-3-(2-nitroanilino)oxolane-2,5-dione |
| SMILES | O=C1C[C@H](Nc2ccccc2[N+](=O)[O-])C(=O)O1 |
| InChI | InChI=1S/C10H8N2O5/c13-9-5-7(10(14)17-9)11-6-3-1-2-4-8(6)12(15)16/h1-4,7,11H,5H2/t7-/m0/s1 |
| InChIKey | LSHWXNHVODTZPR-ZETCQYMHSA-N |
| XLogP | 0.85 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|