C12H17BrN2S — CID 8775212
(4-bromophenyl)methyl N'-(2-methylpropyl)carbamimidothioate (PubChem CID 8775212) has the molecular formula C12H17BrN2S and a molecular weight of 301.25 g/mol. Its IUPAC name is (4-bromophenyl)methyl N'-(2-methylpropyl)carbamimidothioate.
| Compound Name | (4-bromophenyl)methyl N'-(2-methylpropyl)carbamimidothioate |
|---|---|
| PubChem CID | 8775212 |
| Molecular Formula | C12H17BrN2S |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | (4-bromophenyl)methyl N'-(2-methylpropyl)carbamimidothioate |
| SMILES | CC(C)C/N=C(\N)SCc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H17BrN2S/c1-9(2)7-15-12(14)16-8-10-3-5-11(13)6-4-10/h3-6,9H,7-8H2,1-2H3,(H2,14,15) |
| InChIKey | PDTZKJXXNGPSNB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|