C18H12Br10 — CID 87754350
1-(1,2,2,3,3,4,4,5,5,5-decabromo-1-phenylpentyl)-3-methylbenzene (PubChem CID 87754350) has the molecular formula C18H12Br10 and a molecular weight of 1027.33 g/mol. Its IUPAC name is 1-(1,2,2,3,3,4,4,5,5,5-decabromo-1-phenylpentyl)-3-methylbenzene.
| Compound Name | 1-(1,2,2,3,3,4,4,5,5,5-decabromo-1-phenylpentyl)-3-methylbenzene |
|---|---|
| PubChem CID | 87754350 |
| Molecular Formula | C18H12Br10 |
| Molecular Weight | 1027.33 g/mol |
| Exact Mass | 1017.28 |
| IUPAC Name | 1-(1,2,2,3,3,4,4,5,5,5-decabromo-1-phenylpentyl)-3-methylbenzene |
| SMILES | Cc1cccc(C(Br)(c2ccccc2)C(Br)(Br)C(Br)(Br)C(Br)(Br)C(Br)(Br)Br)c1 |
| InChI | InChI=1S/C18H12Br10/c1-11-6-5-9-13(10-11)14(19,12-7-3-2-4-8-12)15(20,21)16(22,23)17(24,25)18(26,27)28/h2-10H,1H3 |
| InChIKey | SSXKLAYUMWMMLE-UHFFFAOYSA-N |
| XLogP | 10.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.33 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|