C19H30O7 — CID 87756267
3-hydroxypropyl 2-methylprop-2-enoate;5-methylidene-2-pentylhex-2-enedioic acid (PubChem CID 87756267) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is 3-hydroxypropyl 2-methylprop-2-enoate;5-methylidene-2-pentylhex-2-enedioic acid.
| Compound Name | 3-hydroxypropyl 2-methylprop-2-enoate;5-methylidene-2-pentylhex-2-enedioic acid |
|---|---|
| PubChem CID | 87756267 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-hydroxypropyl 2-methylprop-2-enoate;5-methylidene-2-pentylhex-2-enedioic acid |
| SMILES | C=C(C)C(=O)OCCCO.C=C(CC=C(CCCCC)C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18O4.C7H12O3/c1-3-4-5-6-10(12(15)16)8-7-9(2)11(13)14;1-6(2)7(9)10-5-3-4-8/h8H,2-7H2,1H3,(H,13,14)(H,15,16);8H,1,3-5H2,2H3 |
| InChIKey | LQYFJJBLEWCCPH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|