About 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid
2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid (PubChem CID 87757190) has the molecular formula C26H54As2O4S2
and a molecular weight of 644.69 g/mol. Its IUPAC name is 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid.
Molecular Properties
| Compound Name | 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid |
| PubChem CID | 87757190 |
| Molecular Formula | C26H54As2O4S2 |
| Molecular Weight | 644.69 g/mol |
| Exact Mass | 644.19 |
| IUPAC Name | 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid |
| SMILES | CCCCCCCCCC(S[As](C)C)C(=O)O.C[As](C)SCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/2C13H27AsO2S/c1-14(2)17-12-10-8-6-4-3-5-7-9-11-13(15)16;1-4-5-6-7-8-9-10-11-12(13(15)16)17-14(2)3/h3-12H2,1-2H3,(H,15,16);12H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | QVENPRPHZYNRSY-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 644.69 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid?
The IUPAC name of 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid (CID 87757190) is 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid.
What is the SMILES notation for 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid?
The canonical SMILES for 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid is CCCCCCCCCC(S[As](C)C)C(=O)O.C[As](C)SCCCCCCCCCCC(=O)O.
What is the InChIKey of 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid?
The InChIKey is QVENPRPHZYNRSY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H27AsO2S/c1-14(2)17-12-10-8-6-4-3-5-7-9-11-13(15)16;1-4-5-6-7-8-9-10-11-12(13(15)16)17-14(2)3/h3-12H2,1-2H3,(H,15,16);12H,4-11H2,1-3H3,(H,15,16).
What are the key properties of 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid?
2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid has a molecular weight of 644.69 g/mol, XLogP of 9.13, 23 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylarsanylsulfanylundecanoic acid;11-dimethylarsanylsulfanylundecanoic acid is sourced from PubChem (CID 87757190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).