C17H27N3O3S2 — CID 8775921
(3-morpholin-4-ylsulfonylphenyl)methyl N'-(3-methylbutyl)carbamimidothioate (PubChem CID 8775921) has the molecular formula C17H27N3O3S2 and a molecular weight of 385.56 g/mol. Its IUPAC name is (3-morpholin-4-ylsulfonylphenyl)methyl N'-(3-methylbutyl)carbamimidothioate.
| Compound Name | (3-morpholin-4-ylsulfonylphenyl)methyl N'-(3-methylbutyl)carbamimidothioate |
|---|---|
| PubChem CID | 8775921 |
| Molecular Formula | C17H27N3O3S2 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (3-morpholin-4-ylsulfonylphenyl)methyl N'-(3-methylbutyl)carbamimidothioate |
| SMILES | CC(C)CC/N=C(\N)SCc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H27N3O3S2/c1-14(2)6-7-19-17(18)24-13-15-4-3-5-16(12-15)25(21,22)20-8-10-23-11-9-20/h3-5,12,14H,6-11,13H2,1-2H3,(H2,18,19) |
| InChIKey | ZDSBIBKUKKRKOR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|