C16H21N3O7 — CID 87761979
[[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(propanoylamino)oxan-2-ylidene]amino] N-phenylcarbamate (PubChem CID 87761979) has the molecular formula C16H21N3O7 and a molecular weight of 367.36 g/mol. Its IUPAC name is [[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(propanoylamino)oxan-2-ylidene]amino] N-phenylcarbamate.
| Compound Name | [[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(propanoylamino)oxan-2-ylidene]amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 87761979 |
| Molecular Formula | C16H21N3O7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | [[(3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-(propanoylamino)oxan-2-ylidene]amino] N-phenylcarbamate |
| SMILES | CCC(=O)N[C@H]1C(=NOC(=O)Nc2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H21N3O7/c1-2-11(21)18-12-14(23)13(22)10(8-20)25-15(12)19-26-16(24)17-9-6-4-3-5-7-9/h3-7,10,12-14,20,22-23H,2,8H2,1H3,(H,17,24)(H,18,21)/t10-,12-,13-,14-/m1/s1 |
| InChIKey | ADGOMNHDQHIKMZ-FMKGYKFTSA-N |
| XLogP | -0.44 |
| TPSA | 149.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|