C24H31N3O10 — CID 11562674
[(2R,3S,4R,5R,6Z)-3,4-diacetyloxy-5-(pentanoylamino)-6-(phenylcarbamoyloxyimino)oxan-2-yl]methyl acetate (PubChem CID 11562674) has the molecular formula C24H31N3O10 and a molecular weight of 521.52 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6Z)-3,4-diacetyloxy-5-(pentanoylamino)-6-(phenylcarbamoyloxyimino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6Z)-3,4-diacetyloxy-5-(pentanoylamino)-6-(phenylcarbamoyloxyimino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11562674 |
| Molecular Formula | C24H31N3O10 |
| Molecular Weight | 521.52 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | [(2R,3S,4R,5R,6Z)-3,4-diacetyloxy-5-(pentanoylamino)-6-(phenylcarbamoyloxyimino)oxan-2-yl]methyl acetate |
| SMILES | CCCCC(=O)N[C@H]1/C(=N/OC(=O)Nc2ccccc2)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H31N3O10/c1-5-6-12-19(31)26-20-22(35-16(4)30)21(34-15(3)29)18(13-33-14(2)28)36-23(20)27-37-24(32)25-17-10-8-7-9-11-17/h7-11,18,20-22H,5-6,12-13H2,1-4H3,(H,25,32)(H,26,31)/b27-23-/t18-,20-,21-,22-/m1/s1 |
| InChIKey | SPEVHRHAEZJBOE-NZDVVXMKSA-N |
| XLogP | 2.05 |
| TPSA | 167.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.52 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|