C16H30O4 — CID 87770622
4-(dimethoxymethyl)-4-ethyl-2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 87770622) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-4-ethyl-2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | 4-(dimethoxymethyl)-4-ethyl-2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 87770622 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 4-(dimethoxymethyl)-4-ethyl-2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | CCC(C(=O)C(C)(C)C)(C(=O)C(C)(C)C)C(OC)OC |
| InChI | InChI=1S/C16H30O4/c1-10-16(13(19-8)20-9,11(17)14(2,3)4)12(18)15(5,6)7/h13H,10H2,1-9H3 |
| InChIKey | DORUOOCLYJWEDY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|