C7H15O8P — CID 87770719
[(2S,3S,4R)-3,4,5-trihydroxy-2-[(1R)-1-hydroxy-2-oxoethyl]pentyl]phosphonic acid (PubChem CID 87770719) has the molecular formula C7H15O8P and a molecular weight of 258.16 g/mol. Its IUPAC name is [(2S,3S,4R)-3,4,5-trihydroxy-2-[(1R)-1-hydroxy-2-oxoethyl]pentyl]phosphonic acid.
| Compound Name | [(2S,3S,4R)-3,4,5-trihydroxy-2-[(1R)-1-hydroxy-2-oxoethyl]pentyl]phosphonic acid |
|---|---|
| PubChem CID | 87770719 |
| Molecular Formula | C7H15O8P |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | [(2S,3S,4R)-3,4,5-trihydroxy-2-[(1R)-1-hydroxy-2-oxoethyl]pentyl]phosphonic acid |
| SMILES | O=C[C@H](O)[C@@H](CP(=O)(O)O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H15O8P/c8-1-5(10)4(3-16(13,14)15)7(12)6(11)2-9/h1,4-7,9-12H,2-3H2,(H2,13,14,15)/t4-,5+,6-,7+/m1/s1 |
| InChIKey | VLLVLHAKAVPPJW-UCROKIRRSA-N |
| XLogP | -2.95 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|