C12H18N2O3S — CID 87783533
[1,3-bis(prop-2-enyl)-2H-imidazol-2-yl] prop-2-ene-1-sulfonate (PubChem CID 87783533) has the molecular formula C12H18N2O3S and a molecular weight of 270.35 g/mol. Its IUPAC name is [1,3-bis(prop-2-enyl)-2H-imidazol-2-yl] prop-2-ene-1-sulfonate.
| Compound Name | [1,3-bis(prop-2-enyl)-2H-imidazol-2-yl] prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 87783533 |
| Molecular Formula | C12H18N2O3S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | [1,3-bis(prop-2-enyl)-2H-imidazol-2-yl] prop-2-ene-1-sulfonate |
| SMILES | C=CCN1C=CN(CC=C)C1OS(=O)(=O)CC=C |
| InChI | InChI=1S/C12H18N2O3S/c1-4-7-13-9-10-14(8-5-2)12(13)17-18(15,16)11-6-3/h4-6,9-10,12H,1-3,7-8,11H2 |
| InChIKey | ZBCLEDIRBYCPOA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|