C8H14F6N2Sb- — CID 175588824
1,2-dimethyl-3-prop-2-enyl-2H-imidazole;hexafluoroantimony(1-) (PubChem CID 175588824) has the molecular formula C8H14F6N2Sb- and a molecular weight of 373.96 g/mol. Its IUPAC name is 1,2-dimethyl-3-prop-2-enyl-2H-imidazole;hexafluoroantimony(1-).
| Compound Name | 1,2-dimethyl-3-prop-2-enyl-2H-imidazole;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 175588824 |
| Molecular Formula | C8H14F6N2Sb- |
| Molecular Weight | 373.96 g/mol |
| Exact Mass | 373.01 |
| IUPAC Name | 1,2-dimethyl-3-prop-2-enyl-2H-imidazole;hexafluoroantimony(1-) |
| SMILES | C=CCN1C=CN(C)C1C.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C8H14N2.6FH.Sb/c1-4-5-10-7-6-9(3)8(10)2;;;;;;;/h4,6-8H,1,5H2,2-3H3;6*1H;/q;;;;;;;+5/p-6 |
| InChIKey | GLHWOWRFJBQTRP-UHFFFAOYSA-H |
| XLogP | 3.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|