C10H16N2 — CID 174535033
1-methyl-2,3-bis(prop-2-enyl)-2H-imidazole (PubChem CID 174535033) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 1-methyl-2,3-bis(prop-2-enyl)-2H-imidazole.
| Compound Name | 1-methyl-2,3-bis(prop-2-enyl)-2H-imidazole |
|---|---|
| PubChem CID | 174535033 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 1-methyl-2,3-bis(prop-2-enyl)-2H-imidazole |
| SMILES | C=CCC1N(C)C=CN1CC=C |
| InChI | InChI=1S/C10H16N2/c1-4-6-10-11(3)8-9-12(10)7-5-2/h4-5,8-10H,1-2,6-7H2,3H3 |
| InChIKey | UGEDSVFUBKLKRF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|