C16H16Cl2N4O2S — CID 87792276
S-[2-[(2,5-dichlorophenyl)carbamoyl]hydrazinyl] 4-(dimethylamino)benzenecarbothioate (PubChem CID 87792276) has the molecular formula C16H16Cl2N4O2S and a molecular weight of 399.30 g/mol. Its IUPAC name is S-[2-[(2,5-dichlorophenyl)carbamoyl]hydrazinyl] 4-(dimethylamino)benzenecarbothioate.
| Compound Name | S-[2-[(2,5-dichlorophenyl)carbamoyl]hydrazinyl] 4-(dimethylamino)benzenecarbothioate |
|---|---|
| PubChem CID | 87792276 |
| Molecular Formula | C16H16Cl2N4O2S |
| Molecular Weight | 399.30 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | S-[2-[(2,5-dichlorophenyl)carbamoyl]hydrazinyl] 4-(dimethylamino)benzenecarbothioate |
| SMILES | CN(C)c1ccc(C(=O)SNNC(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C16H16Cl2N4O2S/c1-22(2)12-6-3-10(4-7-12)15(23)25-21-20-16(24)19-14-9-11(17)5-8-13(14)18/h3-9,21H,1-2H3,(H2,19,20,24) |
| InChIKey | ZLKOVALSPWIYRK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|