C28H22Cl2N4O6S — CID 87801998
(2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-[4-[(2,6-dichloropyridine-3-carbonyl)amino]phenyl]propanoic acid (PubChem CID 87801998) has the molecular formula C28H22Cl2N4O6S and a molecular weight of 613.48 g/mol. Its IUPAC name is (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-[4-[(2,6-dichloropyridine-3-carbonyl)amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-[4-[(2,6-dichloropyridine-3-carbonyl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 87801998 |
| Molecular Formula | C28H22Cl2N4O6S |
| Molecular Weight | 613.48 g/mol |
| Exact Mass | 612.06 |
| IUPAC Name | (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-[4-[(2,6-dichloropyridine-3-carbonyl)amino]phenyl]propanoic acid |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)c1ccccc1)N[C@@H](Cc1ccc(NC(=O)c2ccc(Cl)nc2Cl)cc1)C(=O)O |
| InChI | InChI=1S/C28H22Cl2N4O6S/c29-24-15-14-20(25(30)34-24)26(35)31-18-12-10-17(11-13-18)16-22(27(36)37)33-28(38)32-21-8-4-5-9-23(21)41(39,40)19-6-2-1-3-7-19/h1-15,22H,16H2,(H,31,35)(H,36,37)(H2,32,33,38)/t22-/m0/s1 |
| InChIKey | FEICMUUFRBTZDS-QFIPXVFZSA-N |
| XLogP | 5.29 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|