C8H8O5 — CID 87813292
(2-oxo-5-prop-2-enyl-1,3-dioxol-4-yl)methyl formate (PubChem CID 87813292) has the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. Its IUPAC name is (2-oxo-5-prop-2-enyl-1,3-dioxol-4-yl)methyl formate.
| Compound Name | (2-oxo-5-prop-2-enyl-1,3-dioxol-4-yl)methyl formate |
|---|---|
| PubChem CID | 87813292 |
| Molecular Formula | C8H8O5 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | (2-oxo-5-prop-2-enyl-1,3-dioxol-4-yl)methyl formate |
| SMILES | C=CCc1oc(=O)oc1COC=O |
| InChI | InChI=1S/C8H8O5/c1-2-3-6-7(4-11-5-9)13-8(10)12-6/h2,5H,1,3-4H2 |
| InChIKey | SZVXJGBBAXBLMZ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 69.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|