C25H27NO3S — CID 87814690
4-[2-hydroxy-3-methyl-4-[[3-(pyridin-4-ylsulfanylmethyl)phenyl]methoxy]phenyl]-3-methylbutanal (PubChem CID 87814690) has the molecular formula C25H27NO3S and a molecular weight of 421.56 g/mol. Its IUPAC name is 4-[2-hydroxy-3-methyl-4-[[3-(pyridin-4-ylsulfanylmethyl)phenyl]methoxy]phenyl]-3-methylbutanal.
| Compound Name | 4-[2-hydroxy-3-methyl-4-[[3-(pyridin-4-ylsulfanylmethyl)phenyl]methoxy]phenyl]-3-methylbutanal |
|---|---|
| PubChem CID | 87814690 |
| Molecular Formula | C25H27NO3S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 4-[2-hydroxy-3-methyl-4-[[3-(pyridin-4-ylsulfanylmethyl)phenyl]methoxy]phenyl]-3-methylbutanal |
| SMILES | Cc1c(OCc2cccc(CSc3ccncc3)c2)ccc(CC(C)CC=O)c1O |
| InChI | InChI=1S/C25H27NO3S/c1-18(10-13-27)14-22-6-7-24(19(2)25(22)28)29-16-20-4-3-5-21(15-20)17-30-23-8-11-26-12-9-23/h3-9,11-13,15,18,28H,10,14,16-17H2,1-2H3 |
| InChIKey | ASYXFLCSWVHBGA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|