C11H19N3O — CID 87814796
2-ethyl-5-(5-ethyl-1,2,4-triazol-1-yl)pentanal (PubChem CID 87814796) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-ethyl-5-(5-ethyl-1,2,4-triazol-1-yl)pentanal.
| Compound Name | 2-ethyl-5-(5-ethyl-1,2,4-triazol-1-yl)pentanal |
|---|---|
| PubChem CID | 87814796 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-ethyl-5-(5-ethyl-1,2,4-triazol-1-yl)pentanal |
| SMILES | CCc1ncnn1CCCC(C=O)CC |
| InChI | InChI=1S/C11H19N3O/c1-3-10(8-15)6-5-7-14-11(4-2)12-9-13-14/h8-10H,3-7H2,1-2H3 |
| InChIKey | ZHKREHJHTPMUIZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|