C37H34N2 — CID 87819794
2-(3-butyl-4,5-diphenylphenyl)ethenyl-(3-methyl-5-phenylphenyl)diazene (PubChem CID 87819794) has the molecular formula C37H34N2 and a molecular weight of 506.69 g/mol. Its IUPAC name is 2-(3-butyl-4,5-diphenylphenyl)ethenyl-(3-methyl-5-phenylphenyl)diazene.
| Compound Name | 2-(3-butyl-4,5-diphenylphenyl)ethenyl-(3-methyl-5-phenylphenyl)diazene |
|---|---|
| PubChem CID | 87819794 |
| Molecular Formula | C37H34N2 |
| Molecular Weight | 506.69 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-(3-butyl-4,5-diphenylphenyl)ethenyl-(3-methyl-5-phenylphenyl)diazene |
| SMILES | CCCCc1cc(C=C/N=N/c2cc(C)cc(-c3ccccc3)c2)cc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C37H34N2/c1-3-4-14-33-25-29(26-36(31-17-10-6-11-18-31)37(33)32-19-12-7-13-20-32)21-22-38-39-35-24-28(2)23-34(27-35)30-15-8-5-9-16-30/h5-13,15-27H,3-4,14H2,1-2H3/b22-21?,39-38+ |
| InChIKey | HVSQHZXFMSWAMZ-AEYFISKDSA-N |
| XLogP | 11.09 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.69 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|