C43H54N2 — CID 87818651
1-(3,4-dibutyl-5-phenylphenyl)but-1-en-2-yl-(3-hexyl-5-methyl-4-phenylphenyl)diazene (PubChem CID 87818651) has the molecular formula C43H54N2 and a molecular weight of 598.92 g/mol. Its IUPAC name is 1-(3,4-dibutyl-5-phenylphenyl)but-1-en-2-yl-(3-hexyl-5-methyl-4-phenylphenyl)diazene.
| Compound Name | 1-(3,4-dibutyl-5-phenylphenyl)but-1-en-2-yl-(3-hexyl-5-methyl-4-phenylphenyl)diazene |
|---|---|
| PubChem CID | 87818651 |
| Molecular Formula | C43H54N2 |
| Molecular Weight | 598.92 g/mol |
| Exact Mass | 598.43 |
| IUPAC Name | 1-(3,4-dibutyl-5-phenylphenyl)but-1-en-2-yl-(3-hexyl-5-methyl-4-phenylphenyl)diazene |
| SMILES | CCCCCCc1cc(/N=N/C(=Cc2cc(CCCC)c(CCCC)c(-c3ccccc3)c2)CC)cc(C)c1-c1ccccc1 |
| InChI | InChI=1S/C43H54N2/c1-6-10-13-16-26-38-32-40(28-33(5)43(38)36-24-19-15-20-25-36)45-44-39(9-4)30-34-29-37(21-11-7-2)41(27-12-8-3)42(31-34)35-22-17-14-18-23-35/h14-15,17-20,22-25,28-32H,6-13,16,21,26-27H2,1-5H3/b39-30?,45-44+ |
| InChIKey | ITIQDJGZBIXMRJ-OILGUMHYSA-N |
| XLogP | 13.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.92 |
| LogP ≤ 5 | 13.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|