C37H51N2+ — CID 90717182
(4-butyl-3-ethyl-5-phenylphenyl)imino-[1-(3-hexyl-4,5-dimethylphenyl)but-1-en-2-yl]-methylazanium (PubChem CID 90717182) has the molecular formula C37H51N2+ and a molecular weight of 523.83 g/mol. Its IUPAC name is (4-butyl-3-ethyl-5-phenylphenyl)imino-[1-(3-hexyl-4,5-dimethylphenyl)but-1-en-2-yl]-methylazanium.
| Compound Name | (4-butyl-3-ethyl-5-phenylphenyl)imino-[1-(3-hexyl-4,5-dimethylphenyl)but-1-en-2-yl]-methylazanium |
|---|---|
| PubChem CID | 90717182 |
| Molecular Formula | C37H51N2+ |
| Molecular Weight | 523.83 g/mol |
| Exact Mass | 523.40 |
| IUPAC Name | (4-butyl-3-ethyl-5-phenylphenyl)imino-[1-(3-hexyl-4,5-dimethylphenyl)but-1-en-2-yl]-methylazanium |
| SMILES | CCCCCCc1cc(C=C(CC)/[N+](C)=N/c2cc(CC)c(CCCC)c(-c3ccccc3)c2)cc(C)c1C |
| InChI | InChI=1S/C37H51N2/c1-8-12-14-16-21-33-24-30(23-28(5)29(33)6)25-35(11-4)39(7)38-34-26-31(10-3)36(22-13-9-2)37(27-34)32-19-17-15-18-20-32/h15,17-20,23-27H,8-14,16,21-22H2,1-7H3/q+1/b35-25?,39-38+ |
| InChIKey | DCPRKMAYPBXJPB-SVRRCYCCSA-N |
| XLogP | 11.18 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.83 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|