C36H49N2+ — CID 91512021
(3,4-dimethyl-5-octylphenyl)imino-[1-(3-ethyl-4-methyl-5-phenylphenyl)but-1-en-2-yl]-methylazanium (PubChem CID 91512021) has the molecular formula C36H49N2+ and a molecular weight of 509.80 g/mol. Its IUPAC name is (3,4-dimethyl-5-octylphenyl)imino-[1-(3-ethyl-4-methyl-5-phenylphenyl)but-1-en-2-yl]-methylazanium.
| Compound Name | (3,4-dimethyl-5-octylphenyl)imino-[1-(3-ethyl-4-methyl-5-phenylphenyl)but-1-en-2-yl]-methylazanium |
|---|---|
| PubChem CID | 91512021 |
| Molecular Formula | C36H49N2+ |
| Molecular Weight | 509.80 g/mol |
| Exact Mass | 509.39 |
| IUPAC Name | (3,4-dimethyl-5-octylphenyl)imino-[1-(3-ethyl-4-methyl-5-phenylphenyl)but-1-en-2-yl]-methylazanium |
| SMILES | CCCCCCCCc1cc(/N=[N+](\C)C(=Cc2cc(CC)c(C)c(-c3ccccc3)c2)CC)cc(C)c1C |
| InChI | InChI=1S/C36H49N2/c1-8-11-12-13-14-16-21-33-26-34(22-27(4)28(33)5)37-38(7)35(10-3)24-30-23-31(9-2)29(6)36(25-30)32-19-17-15-18-20-32/h15,17-20,22-26H,8-14,16,21H2,1-7H3/q+1/b35-24?,38-37+ |
| InChIKey | ZTGFXWXGWHVSAA-CWAZNCQFSA-N |
| XLogP | 10.92 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.80 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|