C44H65N2+ — CID 91802398
(3-butyl-5-methyl-4-octylphenyl)imino-methyl-[1-(4-methyl-3-octyl-5-phenylphenyl)prop-1-en-2-yl]azanium (PubChem CID 91802398) has the molecular formula C44H65N2+ and a molecular weight of 622.02 g/mol. Its IUPAC name is (3-butyl-5-methyl-4-octylphenyl)imino-methyl-[1-(4-methyl-3-octyl-5-phenylphenyl)prop-1-en-2-yl]azanium.
| Compound Name | (3-butyl-5-methyl-4-octylphenyl)imino-methyl-[1-(4-methyl-3-octyl-5-phenylphenyl)prop-1-en-2-yl]azanium |
|---|---|
| PubChem CID | 91802398 |
| Molecular Formula | C44H65N2+ |
| Molecular Weight | 622.02 g/mol |
| Exact Mass | 621.51 |
| IUPAC Name | (3-butyl-5-methyl-4-octylphenyl)imino-methyl-[1-(4-methyl-3-octyl-5-phenylphenyl)prop-1-en-2-yl]azanium |
| SMILES | CCCCCCCCc1cc(C=C(C)/[N+](C)=N/c2cc(C)c(CCCCCCCC)c(CCCC)c2)cc(-c2ccccc2)c1C |
| InChI | InChI=1S/C44H65N2/c1-8-11-14-16-18-21-28-40-32-38(33-44(37(40)6)39-26-22-20-23-27-39)31-36(5)46(7)45-42-30-35(4)43(41(34-42)25-13-10-3)29-24-19-17-15-12-9-2/h20,22-23,26-27,30-34H,8-19,21,24-25,28-29H2,1-7H3/q+1/b36-31?,46-45+ |
| InChIKey | GGXSIFLNYMLDQP-NJWUBITCSA-N |
| XLogP | 13.91 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.02 |
| LogP ≤ 5 | 13.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|