C36H48N2 — CID 87818632
2-N-(3,4-dimethyl-5-octylphenyl)-3-N-(3-ethyl-4-methyl-5-phenylphenyl)pentane-2,3-diimine (PubChem CID 87818632) has the molecular formula C36H48N2 and a molecular weight of 508.79 g/mol. Its IUPAC name is 2-N-(3,4-dimethyl-5-octylphenyl)-3-N-(3-ethyl-4-methyl-5-phenylphenyl)pentane-2,3-diimine.
| Compound Name | 2-N-(3,4-dimethyl-5-octylphenyl)-3-N-(3-ethyl-4-methyl-5-phenylphenyl)pentane-2,3-diimine |
|---|---|
| PubChem CID | 87818632 |
| Molecular Formula | C36H48N2 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 2-N-(3,4-dimethyl-5-octylphenyl)-3-N-(3-ethyl-4-methyl-5-phenylphenyl)pentane-2,3-diimine |
| SMILES | CCCCCCCCc1cc(/N=C(C)/C(CC)=N/c2cc(CC)c(C)c(-c3ccccc3)c2)cc(C)c1C |
| InChI | InChI=1S/C36H48N2/c1-8-11-12-13-14-16-21-32-24-33(22-26(4)27(32)5)37-29(7)36(10-3)38-34-23-30(9-2)28(6)35(25-34)31-19-17-15-18-20-31/h15,17-20,22-25H,8-14,16,21H2,1-7H3/b37-29+,38-36+ |
| InChIKey | LWVJFZDZFFSBAV-UZNPDBNESA-N |
| XLogP | 11.02 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|