C45H58N2 — CID 87964388
2-N-(3,5-dibutyl-4-octylphenyl)-1-N-(4-methyl-3,5-diphenylphenyl)butane-1,2-diimine (PubChem CID 87964388) has the molecular formula C45H58N2 and a molecular weight of 626.97 g/mol. Its IUPAC name is 2-N-(3,5-dibutyl-4-octylphenyl)-1-N-(4-methyl-3,5-diphenylphenyl)butane-1,2-diimine.
| Compound Name | 2-N-(3,5-dibutyl-4-octylphenyl)-1-N-(4-methyl-3,5-diphenylphenyl)butane-1,2-diimine |
|---|---|
| PubChem CID | 87964388 |
| Molecular Formula | C45H58N2 |
| Molecular Weight | 626.97 g/mol |
| Exact Mass | 626.46 |
| IUPAC Name | 2-N-(3,5-dibutyl-4-octylphenyl)-1-N-(4-methyl-3,5-diphenylphenyl)butane-1,2-diimine |
| SMILES | CCCCCCCCc1c(CCCC)cc(/N=C(/C=N/c2cc(-c3ccccc3)c(C)c(-c3ccccc3)c2)CC)cc1CCCC |
| InChI | InChI=1S/C45H58N2/c1-6-10-13-14-15-22-29-43-38(23-11-7-2)30-42(31-39(43)24-12-8-3)47-40(9-4)34-46-41-32-44(36-25-18-16-19-26-36)35(5)45(33-41)37-27-20-17-21-28-37/h16-21,25-28,30-34H,6-15,22-24,29H2,1-5H3/b46-34+,47-40+ |
| InChIKey | SIAKDPPYXBAFKC-QIOIHWAJSA-N |
| XLogP | 13.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.97 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|