C37H58N2 — CID 87964792
2-N-(3-butyl-4,5-diethylphenyl)-1-N-(4-butyl-3-methyl-5-octylphenyl)butane-1,2-diimine (PubChem CID 87964792) has the molecular formula C37H58N2 and a molecular weight of 530.89 g/mol. Its IUPAC name is 2-N-(3-butyl-4,5-diethylphenyl)-1-N-(4-butyl-3-methyl-5-octylphenyl)butane-1,2-diimine.
| Compound Name | 2-N-(3-butyl-4,5-diethylphenyl)-1-N-(4-butyl-3-methyl-5-octylphenyl)butane-1,2-diimine |
|---|---|
| PubChem CID | 87964792 |
| Molecular Formula | C37H58N2 |
| Molecular Weight | 530.89 g/mol |
| Exact Mass | 530.46 |
| IUPAC Name | 2-N-(3-butyl-4,5-diethylphenyl)-1-N-(4-butyl-3-methyl-5-octylphenyl)butane-1,2-diimine |
| SMILES | CCCCCCCCc1cc(/N=C/C(CC)=N/c2cc(CC)c(CC)c(CCCC)c2)cc(C)c1CCCC |
| InChI | InChI=1S/C37H58N2/c1-8-14-17-18-19-20-22-32-26-34(24-29(7)37(32)23-16-10-3)38-28-33(12-5)39-35-25-30(11-4)36(13-6)31(27-35)21-15-9-2/h24-28H,8-23H2,1-7H3/b38-28+,39-33+ |
| InChIKey | HKHMXILHSJMABV-YTFVYNBTSA-N |
| XLogP | 11.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.89 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|